6-amino-9-[3-hydroxy-5-[(hydroxy-sulfooxy-phosphoryl)oxymethyl]-4-phosphonooxy-oxolan-2-yl]-purine
![6-amino-9-[3-hydroxy-5-[(hydroxy-sulfooxy-phosphoryl)oxymethyl]-4-phosphonooxy-oxolan-2-yl]-purine Structure](https://image.chemsrc.com/caspic/302/482-67-7.png)
6-amino-9-[3-hydroxy-5-[(hydroxy-sulfooxy-phosphoryl)oxymethyl]-4-phosphonooxy-oxolan-2-yl]-purine structure
|
Common Name | 6-amino-9-[3-hydroxy-5-[(hydroxy-sulfooxy-phosphoryl)oxymethyl]-4-phosphonooxy-oxolan-2-yl]-purine | ||
|---|---|---|---|---|
| CAS Number | 482-67-7 | Molecular Weight | 507.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15N5O13P2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3'-phospho-5'-adenylyl sulfate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H15N5O13P2S |
|---|---|
| Molecular Weight | 507.27 |
| Exact Mass | 506.98623072 |
| PSA | 315.29000 |
| LogP | 0.71510 |
| InChIKey | GACDQMDRPRGCTN-KQYNXXCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OS(=O)(=O)O)OP(=O)(O)O)O)N |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Experimentally measured binding affinity data (Kd) for protein-ligand complexes deriv...
Source: Shanghai Institute of Organic Chemistry
Target: N/A
External Id: PDBbind-Kd for protein-ligand complexes
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3'-Phosphoadenosine-5'-phosphosulfate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3'-phospho-5'-adenylyl sulfate have? |
| A: English synonyms of 3'-phospho-5'-adenylyl sulfate: 3'-Phosphoadenosine-5'-phosphosulfate. |
| Q: What is the Chinese name of 482-67-7? |
| A: Chinese name of 482-67-7 is 482-67-7. |
| Q: What is the English name of 3'-phospho-5'-adenylyl sulfate? |
| A: The English name of 3'-phospho-5'-adenylyl sulfate is 3'-phospho-5'-adenylyl sulfate. |
| Q: What is the molecular formula of 3'-phospho-5'-adenylyl sulfate? |
| A: Molecular formula of 3'-phospho-5'-adenylyl sulfate is C10H15N5O13P2S. |
| Q: What is the CAS number of 3'-phospho-5'-adenylyl sulfate? |
| A: CAS number of 3'-phospho-5'-adenylyl sulfate is 482-67-7. |
| Q: What is the InChIKey of 3'-phospho-5'-adenylyl sulfate? |
| A: InChIKey of 3'-phospho-5'-adenylyl sulfate is GACDQMDRPRGCTN-KQYNXXCUSA-N. |
| Q: What is the polar surface area (PSA) of 3'-phospho-5'-adenylyl sulfate? |
| A: Polar surface area (PSA) of 3'-phospho-5'-adenylyl sulfate is 315.29000. |
| Q: What is the molecular weight of 3'-phospho-5'-adenylyl sulfate? |
| A: Molecular weight of 3'-phospho-5'-adenylyl sulfate is 507.27. |
| Q: What is the LogP of 3'-phospho-5'-adenylyl sulfate? |
| A: LogP of 3'-phospho-5'-adenylyl sulfate is 0.71510. |
| Q: What is the SMILES notation of 3'-phospho-5'-adenylyl sulfate? |
| A: SMILES notation of 3'-phospho-5'-adenylyl sulfate is C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)COP(=O)(O)OS(=O)(=O)O)OP(=O)(O)O)O)N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |