3-(3-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine structure
|
Common Name | 3-(3-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 484-19-5 | Molecular Weight | 318.86400 | |
| Density | 1.212g/cm3 | Boiling Point | 450.1ºC at 760 mmHg | |
| Molecular Formula | C17H19ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226ºC | |
| Name | 3-(3-chlorophenothiazin-10-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 450.1ºC at 760 mmHg |
| Molecular Formula | C17H19ClN2S |
| Molecular Weight | 318.86400 |
| Flash Point | 226ºC |
| Exact Mass | 318.09600 |
| PSA | 31.78000 |
| LogP | 4.95940 |
| Vapour Pressure | 2.72E-08mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | JYNZCQHQWDOOKH-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1c2ccccc2Sc2cc(Cl)ccc21 |
|
~%
3-(3-chlorophen... CAS#:484-19-5 |
| Literature: Yale Journal of the American Chemical Society, 1955 , vol. 77, p. 2270 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Chlor-10-<3-dimethylamino-propyl>-phenothiazin |
| N-<3-Dimethylamino-propyl>-3-chlor-phenothiazin |
| 3-Chloropromazine |