2-ethoxy-3-(2-ethoxy-3,6-difluoro-phenyl)-1,4-difluoro-benzene structure
|
Common Name | 2-ethoxy-3-(2-ethoxy-3,6-difluoro-phenyl)-1,4-difluoro-benzene | ||
|---|---|---|---|---|
| CAS Number | 4841-74-1 | Molecular Weight | 314.27500 | |
| Density | 1.244g/cm3 | Boiling Point | 293.9ºC at 760 mmHg | |
| Molecular Formula | C16H14F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.1ºC | |
| Name | 2-ethoxy-3-(2-ethoxy-3,6-difluorophenyl)-1,4-difluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.244g/cm3 |
|---|---|
| Boiling Point | 293.9ºC at 760 mmHg |
| Molecular Formula | C16H14F4O2 |
| Molecular Weight | 314.27500 |
| Flash Point | 139.1ºC |
| Exact Mass | 314.09300 |
| PSA | 18.46000 |
| LogP | 4.70740 |
| Index of Refraction | 1.493 |
| InChIKey | GXQXJCSAZSYSQD-UHFFFAOYSA-N |
| SMILES | CCOc1c(F)ccc(F)c1-c1c(F)ccc(F)c1OCC |
|
~%
2-ethoxy-3-(2-e... CAS#:4841-74-1 |
| Literature: Holland,D.G.; Tamborski,C. Journal of Organic Chemistry, 1966 , vol. 31, p. 280 - 283 |
|
~%
2-ethoxy-3-(2-e... CAS#:4841-74-1 |
| Literature: Holland,D.G.; Tamborski,C. Journal of Organic Chemistry, 1966 , vol. 31, p. 280 - 283 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,2'-Diethoxy-3,3',6,6'-tetrafluor-biphenyl |
| 2,2'-diethoxy-3,3',6,6'-tetrafluorobiphenyl |