4-(3,4-dicarboxy-2,5,6-trifluoro-phenyl)-3,5,6-trifluoro-phthalic acid structure
|
Common Name | 4-(3,4-dicarboxy-2,5,6-trifluoro-phenyl)-3,5,6-trifluoro-phthalic acid | ||
|---|---|---|---|---|
| CAS Number | 4841-80-9 | Molecular Weight | 438.18900 | |
| Density | 1.904g/cm3 | Boiling Point | 576.6ºC at 760 mmHg | |
| Molecular Formula | C16H4F6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 302.5ºC | |
| Name | 4-(3,4-dicarboxy-2,5,6-trifluorophenyl)-3,5,6-trifluorophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.904g/cm3 |
|---|---|
| Boiling Point | 576.6ºC at 760 mmHg |
| Molecular Formula | C16H4F6O8 |
| Molecular Weight | 438.18900 |
| Flash Point | 302.5ºC |
| Exact Mass | 437.98100 |
| PSA | 149.20000 |
| LogP | 2.98100 |
| Index of Refraction | 1.598 |
| InChIKey | DUEXNLBVFZOZLO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(F)c(F)c(-c2c(F)c(F)c(C(=O)O)c(C(=O)O)c2F)c(F)c1C(=O)O |
|
~%
4-(3,4-dicarbox... CAS#:4841-80-9 |
| Literature: Holland,D.G.; Tamborski,C. Journal of Organic Chemistry, 1966 , vol. 31, p. 280 - 283 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| hexafluorobiphenyl-3,3',4,4'-Tetracarboxylic acid |
| 2,2',5,5',6,6'-hexafluorobiphenyl-3,3',4,4'-tetracarboxylic acid |
| Hexafluor-biphenyl-3,3',4,4'-tetracarbonsaeure |