{[5-(2-Thienyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid structure
|
Common Name | {[5-(2-Thienyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid | ||
|---|---|---|---|---|
| CAS Number | 485334-94-9 | Molecular Weight | 242.275 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 472.1±51.0 °C at 760 mmHg | |
| Molecular Formula | C8H6N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.3±30.4 °C | |
| Name | {[5-(2-Thienyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.1±51.0 °C at 760 mmHg |
| Molecular Formula | C8H6N2O3S2 |
| Molecular Weight | 242.275 |
| Flash Point | 239.3±30.4 °C |
| Exact Mass | 241.981979 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | DDAZVWRCOLWHLI-UHFFFAOYSA-N |
| SMILES | O=C(O)CSc1nnc(-c2cccs2)o1 |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_HPP
|
| {[5-(2-Thienyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid |
| MFCD02741525 |