(2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate
Modify Date: 2026-07-27 11:33:53
(2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate structure
|
Common Name | (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate | ||
|---|---|---|---|---|
| CAS Number | 485809-75-4 | Molecular Weight | 356.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N6O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N6O7 |
|---|---|
| Molecular Weight | 356.29 |
| InChIKey | NXFBOSDFKNUIMG-ZIQFBCGOSA-N |
| SMILES | CC(=O)OC1OC(CN=[N+]=[N-])C(N=[N+]=[N-])C(OC(C)=O)C1OC(C)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 485809-75-4? |
| A: Chinese name of 485809-75-4 is 485809-75-4. |
| Q: What is the molecular formula of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate? |
| A: Molecular formula of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate is C12H16N6O7. |
| Q: What is the English name of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate? |
| A: The English name of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate is (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate. |
| Q: What is the CAS number of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate? |
| A: CAS number of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate is 485809-75-4. |
| Q: What is the SMILES notation of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate? |
| A: SMILES notation of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate is CC(=O)OC1OC(CN=[N+]=[N-])C(N=[N+]=[N-])C(OC(C)=O)C1OC(C)=O. |
| Q: What is the molecular weight of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate? |
| A: Molecular weight of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate is 356.29. |
| Q: What is the InChIKey of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate? |
| A: InChIKey of (2R,3R,4S,5R,6R)-5-Azido-6-(azidomethyl)tetrahydro-2H-pyran-2,3,4-triyl triacetate is NXFBOSDFKNUIMG-ZIQFBCGOSA-N. |