dimethyl 2,2-bis[2-(4-methoxyphenyl)-2-oxoethyl]propanedioate structure
|
Common Name | dimethyl 2,2-bis[2-(4-methoxyphenyl)-2-oxoethyl]propanedioate | ||
|---|---|---|---|---|
| CAS Number | 485819-17-8 | Molecular Weight | 428.43200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2,2-bis[2-(4-methoxyphenyl)-2-oxoethyl]propanedioate |
|---|
| Molecular Formula | C23H24O8 |
|---|---|
| Molecular Weight | 428.43200 |
| Exact Mass | 428.14700 |
| PSA | 105.20000 |
| LogP | 2.88200 |
| InChIKey | VZJYCNRGUSIILQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC(=O)c1ccc(OC)cc1)(CC(=O)c1ccc(OC)cc1)C(=O)OC |
|
~81%
dimethyl 2,2-bi... CAS#:485819-17-8 |
| Literature: Padmavathi; Balaiah; Reddy, M. Muralidhar; Reddy, D. Bhaskar Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2003 , vol. 42, # 6 p. 1519 - 1522 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |