2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-6-hydroxy-7-methoxybenzofuran-3(2H)-one
Modify Date: 2025-09-23 18:02:25
![2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-6-hydroxy-7-methoxybenzofuran-3(2H)-one Structure](https://image.chemsrc.com/caspic/360/486-24-8.png)
2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-6-hydroxy-7-methoxybenzofuran-3(2H)-one structure
|
Common Name | 2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-6-hydroxy-7-methoxybenzofuran-3(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 486-24-8 | Molecular Weight | 300.26300 | |
| Density | 1.554g/cm3 | Boiling Point | 616.7ºC at 760 mmHg | |
| Molecular Formula | C16H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
| Name | leptosidin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 616.7ºC at 760 mmHg |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26300 |
| Flash Point | 236.1ºC |
| Exact Mass | 300.06300 |
| PSA | 96.22000 |
| LogP | 2.42820 |
| Vapour Pressure | 8.36E-16mmHg at 25°C |
| Index of Refraction | 1.747 |
| InChIKey | PFRGTMTYWMVLMU-QPEQYQDCSA-N |
| SMILES | COc1c(O)ccc2c1OC(=Cc1ccc(O)c(O)c1)C2=O |
|
~%
2-[(Z)-(3,4-Dih... CAS#:486-24-8 |
| Literature: Geissman; Moje Journal of the American Chemical Society, 1951 , vol. 73, p. 5765,5767 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: Antiproliferative activity against human HL60 cells assessed as cell survival at 25 u...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL3802694
|
|
Name: Retention time of the compound by UPLC-ESI-MS method
Source: ChEMBL
Target: N/A
External Id: CHEMBL3802697
|
Total 2, Current Page 1 of 1
1
| Leptosidin |
| (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-6-hydroxy-7-methoxy-1-benzofuran-3-one |