2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-6-hydroxy-7-methoxybenzofuran-3(2H)-one
![2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-6-hydroxy-7-methoxybenzofuran-3(2H)-one Structure](https://image.chemsrc.com/caspic/360/486-24-8.png)
2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-6-hydroxy-7-methoxybenzofuran-3(2H)-one structure
|
Common Name | 2-[(Z)-(3,4-Dihydroxyphenyl)methylene]-6-hydroxy-7-methoxybenzofuran-3(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 486-24-8 | Molecular Weight | 300.26300 | |
| Density | 1.554g/cm3 | Boiling Point | 616.7ºC at 760 mmHg | |
| Molecular Formula | C16H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | leptosidin |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 616.7ºC at 760 mmHg |
| Molecular Formula | C16H12O6 |
| Molecular Weight | 300.26300 |
| Flash Point | 236.1ºC |
| Exact Mass | 300.06300 |
| PSA | 96.22000 |
| LogP | 2.42820 |
| Vapour Pressure | 8.36E-16mmHg at 25°C |
| Index of Refraction | 1.747 |
| InChIKey | PFRGTMTYWMVLMU-QPEQYQDCSA-N |
| SMILES | COc1c(O)ccc2c1OC(=Cc1ccc(O)c(O)c1)C2=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-[(Z)-(3,4-Dih... CAS#:486-24-8 |
| Literature: Geissman; Moje Journal of the American Chemical Society, 1951 , vol. 73, p. 5765,5767 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Antiproliferative activity against human HL60 cells assessed as cell survival at 25 u...
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL3802694
|
|
Name: Retention time of the compound by UPLC-ESI-MS method
Source: ChEMBL
Target: N/A
External Id: CHEMBL3802697
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Leptosidin |
| (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-6-hydroxy-7-methoxy-1-benzofuran-3-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does leptosidin have? |
| A: English synonyms of leptosidin: Leptosidin, (2Z)-2-[(3,4-dihydroxyphenyl)methylidene]-6-hydroxy-7-methoxy-1-benzofuran-3-one. |
| Q: What is the polar surface area (PSA) of leptosidin? |
| A: Polar surface area (PSA) of leptosidin is 96.22000. |
| Q: What is the CAS number of leptosidin? |
| A: CAS number of leptosidin is 486-24-8. |
| Q: What is the molecular formula of leptosidin? |
| A: Molecular formula of leptosidin is C16H12O6. |
| Q: What is the LogP of leptosidin? |
| A: LogP of leptosidin is 2.42820. |
| Q: What is the molecular weight of leptosidin? |
| A: Molecular weight of leptosidin is 300.26300. |
| Q: What is the InChIKey of leptosidin? |
| A: InChIKey of leptosidin is PFRGTMTYWMVLMU-QPEQYQDCSA-N. |
| Q: What is the Chinese name of 486-24-8? |
| A: Chinese name of 486-24-8 is 486-24-8. |
| Q: What is the English name of leptosidin? |
| A: The English name of leptosidin is leptosidin. |
| Q: What is the boiling point of leptosidin? |
| A: Boiling point of leptosidin is 616.7ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |