5-chloro-1-(3-nitrophenyl)pentan-1-one structure
|
Common Name | 5-chloro-1-(3-nitrophenyl)pentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 487058-74-2 | Molecular Weight | 241.67100 | |
| Density | 1.248g/cm3 | Boiling Point | 349.418ºC at 760 mmHg | |
| Molecular Formula | C11H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.122ºC | |
| Name | 5-chloro-1-(3-nitrophenyl)pentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 349.418ºC at 760 mmHg |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67100 |
| Flash Point | 165.122ºC |
| Exact Mass | 241.05100 |
| PSA | 62.89000 |
| LogP | 3.70980 |
| Index of Refraction | 1.549 |
| InChIKey | GGTSSSWOQWTQRV-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCl)c1cccc([N+](=O)[O-])c1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 5-chloro-1-(3-nitrophenyl)-1-oxopentane |