(E)-isopropyl 2-(2-cyano-3-(5-methylthiophen-2-yl)acrylamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate
Modify Date: 2026-06-20 06:45:25
![(E)-isopropyl 2-(2-cyano-3-(5-methylthiophen-2-yl)acrylamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate Structure](https://www.chemsrc.com/extcaspic/105/488137-66-2.png)
(E)-isopropyl 2-(2-cyano-3-(5-methylthiophen-2-yl)acrylamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate structure
|
Common Name | (E)-isopropyl 2-(2-cyano-3-(5-methylthiophen-2-yl)acrylamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 488137-66-2 | Molecular Weight | 414.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-isopropyl 2-(2-cyano-3-(5-methylthiophen-2-yl)acrylamido)-4,5,6,7-tetrahydrobenzo[b]thiophene-3-carboxylate |
|---|
| Molecular Formula | C21H22N2O3S2 |
|---|---|
| Molecular Weight | 414.5 |
| InChIKey | BWTNKNWCYNXCOC-GXDHUFHOSA-N |
| SMILES | CC1=CC=C(S1)/C=C(\C#N)/C(=O)NC2=C(C3=C(S2)CCCC3)C(=O)OC(C)C |
|
Name: Screen for inhibitors of RMI FANCM (MM2) intereaction
Source: 11908
Target: N/A
External Id: RMI-FANCM-MM2
|
Total 1, Current Page 1 of 1
1