Neuraminic acid,N-acetyl structure
|
Common Name | Neuraminic acid,N-acetyl | ||
|---|---|---|---|---|
| CAS Number | 489-46-3 | Molecular Weight | 309.27000 | |
| Density | 1.64g/cm3 | Boiling Point | 805ºC at 760mmHg | |
| Molecular Formula | C11H19NO9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 440.7ºC | |
| Name | O-Sialic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 805ºC at 760mmHg |
| Molecular Formula | C11H19NO9 |
| Molecular Weight | 309.27000 |
| Flash Point | 440.7ºC |
| Exact Mass | 309.10600 |
| PSA | 176.78000 |
| Vapour Pressure | 5.5E-30mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | SQVRNKJHWKZAKO-PFQGKNLYSA-N |
| SMILES | CC(=O)NC1C(O)CC(O)(C(=O)O)OC1C(O)C(O)CO |
|
Name: Substrate activity at EGFP-fused human Sialin L22G/L23G mutant expressed in HEK293 ce...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4630268
|
|
Name: Substrate activity mRFP-tagged human recombinant-Sialin L22G/L23G mutant expressed in...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4630270
|
|
Name: Trans-stimulation of human recombinant-Sialin expressed in HEK293 cells assessed as [...
Source: ChEMBL
Target: Sialin
External Id: CHEMBL4630276
|
|
Name: Inhibition of human recombinant-Sialin expressed in HEK293 cells assessed as reductio...
Source: ChEMBL
Target: Sialin
External Id: CHEMBL4630260
|
| diamino-di-tert-butoxy-silane |
| Si,Si-di-tert-butoxy-silanediamine |
| 5-acetamido-3,5-dideoxy-D-glycero-D-galacto-2-nonulopyranosonic acid |
| sialic acid |
| Diamino-di-tert-butoxy-silan |
| Diamino-di-tert-butyloxy-silan |
| 5-acetamido-3,5-dideoxy-D-glycero-D-galacto-non-2-ulosonic acid |