6'-chloro-2-(n-(2-diethylaminoethyl)-n-methylamino)-ortho-acetotoluidide dihydrochloride
Modify Date: 2025-08-25 07:11:02
6'-chloro-2-(n-(2-diethylaminoethyl)-n-methylamino)-ortho-acetotoluidide dihydrochloride structure
|
Common Name | 6'-chloro-2-(n-(2-diethylaminoethyl)-n-methylamino)-ortho-acetotoluidide dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 489-52-1 | Molecular Weight | 383.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H25NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6'-chloro-2-(n-(2-diethylaminoethyl)-n-methylamino)-ortho-acetotoluidide dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H25NO11 |
|---|---|
| Molecular Weight | 383.34800 |
| Exact Mass | 383.14300 |
| PSA | 198.40000 |
| InChIKey | HMQPEDMEOBLSQB-RPHKZZMBSA-N |
| SMILES | CC(=O)NC1C(O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:57467-13-7|
Name: Binding affinity to human Gal-1 assessed as inhibition of Gal-1 binding to immobilize...
Source: ChEMBL
Target: Galectin-1
External Id: CHEMBL4827752
|
|
Name: Binding affinity to human Gal-1 assessed as Gibbs free energy change by isothermal ti...
Source: ChEMBL
Target: Galectin-1
External Id: CHEMBL4827756
|
|
Name: Binding affinity to human Gal-1 assessed as change in enthalpy by isothermal titratio...
Source: ChEMBL
Target: Galectin-1
External Id: CHEMBL4827754
|
|
Name: Binding affinity to human Gal-1 assessed as change in entropy by isothermal titration...
Source: ChEMBL
Target: Galectin-1
External Id: CHEMBL4827755
|
Total 4, Current Page 1 of 1
1
| Galtalc 50SC |
| benopan |
| galipan |
| benzar |
| tillox |
| galtak |
| leymin |
| ben-30 |
| eunasin |