Bis(benzo[d][1,3]dioxol-5-yl)methanone
Modify Date: 2025-10-07 14:20:50
![Bis(benzo[d][1,3]dioxol-5-yl)methanone Structure](https://www.chemsrc.com/extcaspic/372/4892-35-7.png)
Bis(benzo[d][1,3]dioxol-5-yl)methanone structure
|
Common Name | Bis(benzo[d][1,3]dioxol-5-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 4892-35-7 | Molecular Weight | 270.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Bis(benzo[d][1,3]dioxol-5-yl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H10O5 |
|---|---|
| Molecular Weight | 270.24 |
| InChIKey | LSYMBIMGUYAOLS-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Bis(benzo[d][1,3]dioxol-5-yl)methanone? |
| A: CAS number of Bis(benzo[d][1,3]dioxol-5-yl)methanone is 4892-35-7. |
| Q: What is the SMILES notation of Bis(benzo[d][1,3]dioxol-5-yl)methanone? |
| A: SMILES notation of Bis(benzo[d][1,3]dioxol-5-yl)methanone is O=C(c1ccc2c(c1)OCO2)c1ccc2c(c1)OCO2. |
| Q: What is the Chinese name of 4892-35-7? |
| A: Chinese name of 4892-35-7 is 4892-35-7. |
| Q: What is the InChIKey of Bis(benzo[d][1,3]dioxol-5-yl)methanone? |
| A: InChIKey of Bis(benzo[d][1,3]dioxol-5-yl)methanone is LSYMBIMGUYAOLS-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Bis(benzo[d][1,3]dioxol-5-yl)methanone? |
| A: Molecular formula of Bis(benzo[d][1,3]dioxol-5-yl)methanone is C15H10O5. |
| Q: What is the molecular weight of Bis(benzo[d][1,3]dioxol-5-yl)methanone? |
| A: Molecular weight of Bis(benzo[d][1,3]dioxol-5-yl)methanone is 270.24. |
| Q: What is the English name of Bis(benzo[d][1,3]dioxol-5-yl)methanone? |
| A: The English name of Bis(benzo[d][1,3]dioxol-5-yl)methanone is Bis(benzo[d][1,3]dioxol-5-yl)methanone. |