methyl tert-butyl 2-[(3-methyl-2-phenylmethoxycarbonylamino-butanoyl)amino]pentanedioate structure
|
Common Name | methyl tert-butyl 2-[(3-methyl-2-phenylmethoxycarbonylamino-butanoyl)amino]pentanedioate | ||
|---|---|---|---|---|
| CAS Number | 4902-24-3 | Molecular Weight | 450.52500 | |
| Density | 1.137g/cm3 | Boiling Point | 598.3ºC at 760 mmHg | |
| Molecular Formula | C23H34N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.7ºC | |
| Name | 5-O-tert-butyl 1-O-methyl 2-[[3-methyl-2-(phenylmethoxycarbonylamino)butanoyl]amino]pentanedioate |
|---|
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 598.3ºC at 760 mmHg |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.52500 |
| Flash Point | 315.7ºC |
| Exact Mass | 450.23700 |
| PSA | 120.03000 |
| LogP | 3.49890 |
| Index of Refraction | 1.505 |
| InChIKey | HGLSLBNWAQWNLK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CCC(=O)OC(C)(C)C)NC(=O)C(NC(=O)OCc1ccccc1)C(C)C |
|
~%
methyl tert-but... CAS#:4902-24-3 |
| Literature: Katsoyannis,P.G. et al. Journal of the American Chemical Society, 1966 , vol. 88, # 1 p. 166 - 167 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |