(4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester
Modify Date: 2026-06-25 18:55:39
(4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester structure
|
Common Name | (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester | ||
|---|---|---|---|---|
| CAS Number | 4910-41-2 | Molecular Weight | 409.32900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19F4NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H19F4NO6 |
|---|---|
| Molecular Weight | 409.32900 |
| Exact Mass | 409.11500 |
| PSA | 90.93000 |
| LogP | 2.18610 |
| InChIKey | FYVATRKXEGXQGU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1c(F)c(F)c(OC)c(F)c1F)(NC(C)=O)C(=O)OCC |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Methoxy-2.3.5.6-tetrafluor-benzyl-diethylacetamidomalonat |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester? |
| A: Molecular weight of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester is 409.32900. |
| Q: What is the polar surface area (PSA) of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester? |
| A: Polar surface area (PSA) of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester is 90.93000. |
| Q: What is the InChIKey of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester? |
| A: InChIKey of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester is FYVATRKXEGXQGU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester? |
| A: SMILES notation of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester is CCOC(=O)C(Cc1c(F)c(F)c(OC)c(F)c1F)(NC(C)=O)C(=O)OCC. |
| Q: What English synonyms does (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester have? |
| A: English synonyms of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester: 4-Methoxy-2.3.5.6-tetrafluor-benzyl-diethylacetamidomalonat. |
| Q: What is the LogP of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester? |
| A: LogP of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester is 2.18610. |
| Q: What is the Chinese name of 4910-41-2? |
| A: Chinese name of 4910-41-2 is 4910-41-2. |
| Q: What is the molecular formula of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester? |
| A: Molecular formula of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester is C17H19F4NO6. |
| Q: What is the CAS number of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester? |
| A: CAS number of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester is 4910-41-2. |
| Q: What is the English name of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester? |
| A: The English name of (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester is (4-Methoxy-2.3.5.6-tetrafluor-benzyl)-acetamido-malonsaeure-diethylester. |