4-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]benzoic acid structure
|
Common Name | 4-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 491831-83-5 | Molecular Weight | 295.67900 | |
| Density | 1.53g/cm3 | Boiling Point | 535.8ºC at 760 mmHg | |
| Molecular Formula | C12H10ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.8ºC | |
| Name | 4-[(4-chloro-5-methyl-3-nitropyrazol-1-yl)methyl]benzoic acid |
|---|
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 535.8ºC at 760 mmHg |
| Molecular Formula | C12H10ClN3O4 |
| Molecular Weight | 295.67900 |
| Flash Point | 277.8ºC |
| Exact Mass | 295.03600 |
| PSA | 100.94000 |
| LogP | 3.02280 |
| Index of Refraction | 1.664 |
| InChIKey | RPDSHNBIFOPINO-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)c([N+](=O)[O-])nn1Cc1ccc(C(=O)O)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |