(7-methoxy-2-methylsulfanylquinolin-3-yl)-phenylmethanone
Modify Date: 2025-09-19 10:31:48
(7-methoxy-2-methylsulfanylquinolin-3-yl)-phenylmethanone structure
|
Common Name | (7-methoxy-2-methylsulfanylquinolin-3-yl)-phenylmethanone | ||
|---|---|---|---|---|
| CAS Number | 491869-90-0 | Molecular Weight | 309.38200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (7-methoxy-2-methylsulfanylquinolin-3-yl)-phenylmethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H15NO2S |
|---|---|
| Molecular Weight | 309.38200 |
| Exact Mass | 309.08200 |
| PSA | 64.49000 |
| LogP | 4.19630 |
| InChIKey | CBUIWRRUJLAQRB-UHFFFAOYSA-N |
| SMILES | COc1ccc2cc(C(=O)c3ccccc3)c(SC)nc2c1 |
|
~%
(7-methoxy-2-me... CAS#:491869-90-0 |
| Literature: Mahata; Venkatesh; Syam Kumar; Ila; Junjappa Journal of Organic Chemistry, 2003 , vol. 68, # 10 p. 3966 - 3975 |
|
~%
(7-methoxy-2-me... CAS#:491869-90-0 |
| Literature: Mahata; Venkatesh; Syam Kumar; Ila; Junjappa Journal of Organic Chemistry, 2003 , vol. 68, # 10 p. 3966 - 3975 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-benzoyl-7-methoxy-2-methylthioquinoline |