ethyl 4-(2,6-difluorophenyl)-4-oxobutanoate structure
|
Common Name | ethyl 4-(2,6-difluorophenyl)-4-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 493004-53-8 | Molecular Weight | 242.21900 | |
| Density | 1.217g/cm3 | Boiling Point | 319.6ºC at 760 mmHg | |
| Molecular Formula | C12H12F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.3ºC | |
| Name | ethyl 4-(2,6-difluorophenyl)-4-oxobutanoate |
|---|
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 319.6ºC at 760 mmHg |
| Molecular Formula | C12H12F2O3 |
| Molecular Weight | 242.21900 |
| Flash Point | 142.3ºC |
| Exact Mass | 242.07500 |
| PSA | 43.37000 |
| LogP | 2.49080 |
| Index of Refraction | 1.48 |
| InChIKey | AINAHYKZRYTOQG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)c1c(F)cccc1F |
| HS Code | 2918300090 |
|---|
|
~59%
ethyl 4-(2,6-di... CAS#:493004-53-8 |
| Literature: US2004/236147 A1, ; Page 11-12 ; |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |