tert-butyl N-[[1-benzyl-4-(hydroxymethyl)piperidin-4-yl]methyl]carbamate
Modify Date: 2025-09-24 17:29:00
![tert-butyl N-[[1-benzyl-4-(hydroxymethyl)piperidin-4-yl]methyl]carbamate Structure](https://image.chemsrc.com/caspic/409/493026-45-2.png)
tert-butyl N-[[1-benzyl-4-(hydroxymethyl)piperidin-4-yl]methyl]carbamate structure
|
Common Name | tert-butyl N-[[1-benzyl-4-(hydroxymethyl)piperidin-4-yl]methyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 493026-45-2 | Molecular Weight | 334.45300 | |
| Density | 1.083g/cm3 | Boiling Point | 462.526ºC at 760 mmHg | |
| Molecular Formula | C19H30N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.528ºC | |
| Name | tert-butyl N-[[1-benzyl-4-(hydroxymethyl)piperidin-4-yl]methyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.083g/cm3 |
|---|---|
| Boiling Point | 462.526ºC at 760 mmHg |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.45300 |
| Flash Point | 233.528ºC |
| Exact Mass | 334.22600 |
| PSA | 61.80000 |
| LogP | 3.11460 |
| Index of Refraction | 1.528 |
| InChIKey | QYRPBJOQULGMSP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1(CO)CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (1-Benzyl-4-hydroxymethylpiperidin-4-ylmethyl)carbamic acid tert-butyl ester |
| [[4-hydroxymethyl-1-(phenylmethyl)-4-piperidinyl]methyl]carbamic acid 1,1-dimethylethyl ester |