Oxazole,2,2'-(1,4-phenylene)bis[5-[1,1'-biphenyl]-4-yl- structure
|
Common Name | Oxazole,2,2'-(1,4-phenylene)bis[5-[1,1'-biphenyl]-4-yl- | ||
|---|---|---|---|---|
| CAS Number | 494-67-7 | Molecular Weight | 516.58800 | |
| Density | 1.192g/cm3 | Boiling Point | 765.2ºC at 760 mmHg | |
| Molecular Formula | C36H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 413.3ºC | |
| Name | 5-(4-phenylphenyl)-2-[4-[5-(4-phenylphenyl)-1,3-oxazol-2-yl]phenyl]-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 765.2ºC at 760 mmHg |
| Molecular Formula | C36H24N2O2 |
| Molecular Weight | 516.58800 |
| Flash Point | 413.3ºC |
| Exact Mass | 516.18400 |
| PSA | 52.06000 |
| LogP | 9.66460 |
| Vapour Pressure | 2.14E-22mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | WQOWDLAMIYDJOZ-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2ccc(-c3cnc(-c4ccc(-c5ncc(-c6ccc(-c7ccccc7)cc6)o5)cc4)o3)cc2)cc1 |
|
~%
Oxazole,2,2'-(1... CAS#:494-67-7 |
| Literature: Hayes et al. Journal of the American Chemical Society, 1955 , vol. 77, p. 1850 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,2'-benzene-1,4-diylbis[5-(biphenyl-4-yl)-1,3-oxazole] |
| 1,4-bis-(5-biphenyl-4-yl-oxazol-2-yl)-benzene |
| 1,4-Bis-(5-biphenyl-4-yl-oxazol-2-yl)-benzol |
| 5,5'-bis-biphenyl-4-yl-2,2'-p-phenylene-bis-oxazole |
| Oxazole,2,2'-(1,4-phenylene)bis[5-[1,1'-biphenyl]-4-yl |