ethyl 4-(2-hydroxyphenyl)-2,4-dioxobutanoate structure
|
Common Name | ethyl 4-(2-hydroxyphenyl)-2,4-dioxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 4940-37-8 | Molecular Weight | 236.22100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(2-hydroxyphenyl)-2,4-dioxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12O5 |
|---|---|
| Molecular Weight | 236.22100 |
| Exact Mass | 236.06800 |
| PSA | 80.67000 |
| LogP | 1.09720 |
| InChIKey | PSFPQJSCHOSMAE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccccc1O |
| HS Code | 2918990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Aethyl-o-benzoylpyruvat |
| 3-[2-Hydroxy-benzoyl]-brenztraubensaeure-aethylester |
| 4-(2-Hydroxy-phenyl)-2,4-dioxo-buttersaeure-aethylester |
| 4-(2-hydroxy-phenyl)-2,4-dioxo-butyric acid ethyl ester |