1,3-diphenyl-2-buten-1-one structure
|
Common Name | 1,3-diphenyl-2-buten-1-one | ||
|---|---|---|---|---|
| CAS Number | 495-45-4 | Molecular Weight | 222.28200 | |
| Density | 1.06 g/cm3 | Boiling Point | 342.5ºC at 760 mmHg | |
| Molecular Formula | C16H14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.1ºC | |
| Name | 1,3-diphenyl-2-buten-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.06 g/cm3 |
|---|---|
| Boiling Point | 342.5ºC at 760 mmHg |
| Molecular Formula | C16H14O |
| Molecular Weight | 222.28200 |
| Flash Point | 150.1ºC |
| Exact Mass | 222.10400 |
| PSA | 17.07000 |
| LogP | 3.97280 |
| Vapour Pressure | 7.5E-05mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | PLELHVCQAULGBH-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)c1ccccc1)c1ccccc1 |
| Precursor 0 | |
|---|---|
| DownStream 10 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| ar-Styrylacetophenone |
| DYPNONE |
| 1,3-diphenyl-2-butenone |
| Einecs 207-801-6 |
| Dypenone (6ci) |
| 1,3-diphenylbut-2-en-1-one |
| 1-oxo-1,3-diphenyl-2-butene |