Valtropine structure
|
Common Name | Valtropine | ||
|---|---|---|---|---|
| CAS Number | 495-82-9 | Molecular Weight | 225.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ValtropineValtropine is an alkaloid. Valtropine can be isolated from the leaves of Duboisia myoporoides[1]. |
| Name | 3endo-((S)-2-methyl-butyryloxy)-tropane |
|---|---|
| Synonym | More Synonyms |
| Description | Valtropine is an alkaloid. Valtropine can be isolated from the leaves of Duboisia myoporoides[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C13H23NO2 |
|---|---|
| Molecular Weight | 225.32700 |
| Exact Mass | 225.17300 |
| PSA | 29.54000 |
| LogP | 2.13880 |
| InChIKey | OGQXAZJUVVPCRL-UHFFFAOYSA-N |
| SMILES | CCC(C)C(=O)OC1CC2CCC(C1)N2C |
| (S)-2-Methyl-butyric acid (1R,3R,5S)-8-methyl-8-aza-bicyclo[3.2.1]oct-3-yl ester |
| 3endo-((S)-2-Methyl-butyryloxy)-tropan |
| Valtropine |