2H-1,4-Benzodiazepin-2-one,7-chloro-3-ethoxy-1,3-dihydro-5-phenyl- structure
|
Common Name | 2H-1,4-Benzodiazepin-2-one,7-chloro-3-ethoxy-1,3-dihydro-5-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 4951-07-9 | Molecular Weight | 314.76600 | |
| Density | 1.29g/cm3 | Boiling Point | 480.5ºC at 760mmHg | |
| Molecular Formula | C17H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.4ºC | |
| Name | 7-chloro-3-ethoxy-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 480.5ºC at 760mmHg |
| Molecular Formula | C17H15ClN2O2 |
| Molecular Weight | 314.76600 |
| Flash Point | 244.4ºC |
| Exact Mass | 314.08200 |
| PSA | 50.69000 |
| LogP | 3.06570 |
| Index of Refraction | 1.627 |
| InChIKey | YWSOBIMUIPVQQM-UHFFFAOYSA-N |
| SMILES | CCOC1N=C(c2ccccc2)c2cc(Cl)ccc2NC1=O |
|
~%
2H-1,4-Benzodia... CAS#:4951-07-9 |
| Literature: Yang Journal of Pharmaceutical Sciences, 1994 , vol. 83, # 6 p. 898 - 902 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Etox |
| 2H-1,4-Benzodiazepin-2-one,7-chloro-3-ethoxy-1,3-dihydro-5-phenyl |
| 7-Chlor-3-ethoxy-2-oxo-5-phenyl-2.3-dihydro-1H-1.4-benzodiazepin |
| 7-Chlor-1,3-dihydro-3-ethoxy-5-phenyl-2H-1,4-benzodiazepin-2-on |
| 7-chloro-3-ethoxy-5-phenyl-1,3-dihydro-benzo[e][1,4]diazepin-2-one |
| Nordazepam 3-ethoxy |
| 3-O-ethyloxazepam |