2-Aminomethyl-5-(4-amino-pyrrolo[2,3-d]pyrimidin-7-yl)-tetrahydro-furan-3,4-diol structure
|
Common Name | 2-Aminomethyl-5-(4-amino-pyrrolo[2,3-d]pyrimidin-7-yl)-tetrahydro-furan-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 49554-55-4 | Molecular Weight | 265.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-Aminomethyl-5-(4-amino-pyrrolo[2,3-d]pyrimidin-7-yl)-tetrahydro-furan-3,4-diol |
|---|
| Molecular Formula | C11H15N5O3 |
|---|---|
| Molecular Weight | 265.27 |
| InChIKey | MLVNXWHOOCTPRF-KCGFPETGSA-N |
| SMILES | NCC1OC(n2ccc3c(N)ncnc32)C(O)C1O |
|
Name: Inhibition of recombinant human adenosine kinase
Source: ChEMBL
Target: Adenosine kinase
External Id: CHEMBL642225
|
|
Name: Inhibition of adenosine kinase
Source: ChEMBL
Target: Adenosine kinase
External Id: CHEMBL969249
|