2-methyl-4-phenyl-1,2-diaza-4-azoniacyclopent-3-ene-5-thione structure
|
Common Name | 2-methyl-4-phenyl-1,2-diaza-4-azoniacyclopent-3-ene-5-thione | ||
|---|---|---|---|---|
| CAS Number | 49572-68-1 | Molecular Weight | 191.25300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-4-phenyl-1H-1,2,4-triazol-4-ium-5-thione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9N3S |
|---|---|
| Molecular Weight | 191.25300 |
| Exact Mass | 191.05200 |
| PSA | 21.70000 |
| LogP | 0.60260 |
| InChIKey | CGDXPNXNQKZJOX-UHFFFAOYSA-N |
| SMILES | Cn1c[n+](-c2ccccc2)c([S-])n1 |
|
~39%
2-methyl-4-phen... CAS#:49572-68-1 |
| Literature: Buccheri, Francesco; Cusmano, Giuseppe; Gruttadauria, Michelangelo; Noto, Renato; Werber, Giuseppe Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 5 p. 1447 - 1451 |
|
~61%
Detail
|
| Literature: Buccheri, Francesco; Cusmano, Giuseppe; Gruttadauria, Michelangelo; Noto, Renato; Werber, Giuseppe Journal of Heterocyclic Chemistry, 1997 , vol. 34, # 5 p. 1447 - 1451 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methyl-4-phenyl-1,2,4-triazolium-5-thiolate |