(2,3,6-trichlorophenyl)methanamine structure
|
Common Name | (2,3,6-trichlorophenyl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 4960-49-0 | Molecular Weight | 210.48800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H6Cl3N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3,6-trichlorophenyl)methanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H6Cl3N |
|---|---|
| Molecular Weight | 210.48800 |
| Exact Mass | 208.95700 |
| PSA | 26.02000 |
| LogP | 3.80580 |
| InChIKey | BQTDSTACPKSLCW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)CN)Cl)Cl |
|
~%
(2,3,6-trichlor... CAS#:4960-49-0 |
| Literature: Brimelow et al. Journal of the Chemical Society, 1951 , p. 1208,1212 |
|
~%
(2,3,6-trichlor... CAS#:4960-49-0 |
| Literature: Morley,J.S. Journal of the Chemical Society, 1961 , p. 1414 - 1416 |
| 2,3,6-Trichlorobenzylamin |
| 2,3,6-TRICHLOROBENZYLAMINE |
| 2,3,6-Trichlor-benzylamin |