7-((4-Bromophenyl)((3-hydroxypyridin-2-yl)amino)methyl)quinolin-8-ol
Modify Date: 2026-04-15 18:45:44
7-((4-Bromophenyl)((3-hydroxypyridin-2-yl)amino)methyl)quinolin-8-ol structure
|
Common Name | 7-((4-Bromophenyl)((3-hydroxypyridin-2-yl)amino)methyl)quinolin-8-ol | ||
|---|---|---|---|---|
| CAS Number | 496013-40-2 | Molecular Weight | 422.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H16BrN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-((4-Bromophenyl)((3-hydroxypyridin-2-yl)amino)methyl)quinolin-8-ol |
|---|
| Molecular Formula | C21H16BrN3O2 |
|---|---|
| Molecular Weight | 422.3 |
| InChIKey | DHWYBHIHZZDTBZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C(C=C2)C(C3=CC=C(C=C3)Br)NC4=C(C=CC=N4)O)O)N=C1 |
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: HepG2-CD81
External Id: CHEMBL4483864
|
|
Name: Luciferase/luciferin-expressing antifolate-resistant parasites were used to infect a ...
Source: ChEMBL
Target: Plasmodium berghei
External Id: CHEMBL4483863
|
Total 2, Current Page 1 of 1
1