Isomitraphylline structure
|
Common Name | Isomitraphylline | ||
|---|---|---|---|---|
| CAS Number | 4963-01-3 | Molecular Weight | 368.42600 | |
| Density | 1.335g/cm3 | Boiling Point | 555.185ºC at 760 mmHg | |
| Molecular Formula | C21H24N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.566ºC | |
Use of IsomitraphyllineIsomitraphylline, an oxindole alkaloid, has potent anti-cancer activity[1]. |
| Name | isomitraphylline |
|---|---|
| Synonym | More Synonyms |
| Description | Isomitraphylline, an oxindole alkaloid, has potent anti-cancer activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 555.185ºC at 760 mmHg |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.42600 |
| Flash Point | 289.566ºC |
| Exact Mass | 368.17400 |
| PSA | 67.87000 |
| LogP | 2.13840 |
| Index of Refraction | 1.636 |
| InChIKey | JMIAZDVHNCCPDM-NWQITLLVSA-N |
| SMILES | COC(=O)C1=COC(C)C2CN3CCC4(C(=O)Nc5ccccc54)C3CC12 |
| Pteropodine |
| Isospeciophylline |
| ajmalicine oxindole-A |