N-(7-acetamido-1,3-dioxo-2-benzofuran-4-yl)acetamide structure
|
Common Name | N-(7-acetamido-1,3-dioxo-2-benzofuran-4-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 497147-09-8 | Molecular Weight | 262.21800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(7-acetamido-1,3-dioxo-2-benzofuran-4-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H10N2O5 |
|---|---|
| Molecular Weight | 262.21800 |
| Exact Mass | 262.05900 |
| PSA | 108.55000 |
| LogP | 2.21300 |
| InChIKey | JGGSNWIMDGPDLA-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(NC(C)=O)c2c1C(=O)OC2=O |
|
~%
N-(7-acetamido-... CAS#:497147-09-8 |
| Literature: Sinkeldam, Renatus W.; Van Houtem, Michel H. C. J.; Koeckelberghs, Guy; Vekemans, Jef A. J. M.; Meijer Organic Letters, 2006 , vol. 8, # 3 p. 383 - 385 |
|
~%
N-(7-acetamido-... CAS#:497147-09-8 |
| Literature: Drew; Pearman Journal of the Chemical Society, 1937 , p. 586,590 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,6-Bis-acetylamino-phthalsaeure-anhydrid |
| 3,6-bis-acetylamino-phthalic acid-anhydride |