Acetylgaertneroside structure
|
Common Name | Acetylgaertneroside | ||
|---|---|---|---|---|
| CAS Number | 497178-34-4 | Molecular Weight | 590.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H30O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Acetylgaertneroside |
|---|
| Molecular Formula | C28H30O14 |
|---|---|
| Molecular Weight | 590.5 |
| InChIKey | BDUPWFOFVQZENO-YNFGFELQSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H]3[C@H](C=C[C@@]34C=C(C(=O)O4)C(C5=CC=C(C=C5)O)O)C(=CO2)C(=O)OC)O)O)O |
|
Name: Inhibition of alternative complement pathway activation by complement modulation test
Source: ChEMBL
Target: N/A
External Id: CHEMBL960257
|
|
Name: Inhibition of classical complement pathway activation by complement modulation test
Source: ChEMBL
Target: N/A
External Id: CHEMBL960256
|
|
Name: Antiamoebic activity against Entamoeba histolytica
Source: ChEMBL
Target: Entamoeba histolytica
External Id: CHEMBL3058937
|