2,2-dimethyl-1-phenyl-1-sulfanylidene-1$l^C13H17OPS-phosphacyclohexan-4-one structure
|
Common Name | 2,2-dimethyl-1-phenyl-1-sulfanylidene-1$l^C13H17OPS-phosphacyclohexan-4-one | ||
|---|---|---|---|---|
| CAS Number | 4972-19-4 | Molecular Weight | 247.27300 | |
| Density | 1.43g/cm3 | Boiling Point | 390.1ºC at 760 mmHg | |
| Molecular Formula | C11H9N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.7ºC | |
| Name | 2-(3-nitropyridin-4-yl)sulfanylaniline |
|---|
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 390.1ºC at 760 mmHg |
| Molecular Formula | C11H9N3O2S |
| Molecular Weight | 247.27300 |
| Flash Point | 189.7ºC |
| Exact Mass | 247.04200 |
| PSA | 110.03000 |
| LogP | 3.82760 |
| Index of Refraction | 1.703 |
| InChIKey | NSMUMAYBVIVGIP-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1Sc1ccncc1[N+](=O)[O-] |
|
~%
2,2-dimethyl-1-... CAS#:4972-19-4 |
| Literature: Saggiomo et al. Journal of Organic Chemistry, 1958 , vol. 23, p. 1906,1908 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |