1-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)propan-1-amine structure
|
Common Name | 1-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)propan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 497246-99-8 | Molecular Weight | 286.36900 | |
| Density | 1.073g/cm3 | Boiling Point | 413.3ºC at 760 mmHg | |
| Molecular Formula | C17H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.8ºC | |
| Name | 1-(3,4-dimethoxyphenyl)-N-(pyridin-3-ylmethyl)propan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.073g/cm3 |
|---|---|
| Boiling Point | 413.3ºC at 760 mmHg |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.36900 |
| Flash Point | 203.8ºC |
| Exact Mass | 286.16800 |
| PSA | 43.38000 |
| LogP | 3.73060 |
| Index of Refraction | 1.547 |
| InChIKey | CHEYOVHGAFSPII-UHFFFAOYSA-N |
| SMILES | CCC(NCc1cccnc1)c1ccc(OC)c(OC)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms1373d18 |