4-benzyl-2,6-ditert-butylphenol structure
|
Common Name | 4-benzyl-2,6-ditert-butylphenol | ||
|---|---|---|---|---|
| CAS Number | 4973-27-7 | Molecular Weight | 296.44600 | |
| Density | 0.986g/cm3 | Boiling Point | 364.3ºC at 760 mmHg | |
| Molecular Formula | C21H28O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | 4-benzyl-2,6-ditert-butylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.986g/cm3 |
|---|---|
| Boiling Point | 364.3ºC at 760 mmHg |
| Molecular Formula | C21H28O |
| Molecular Weight | 296.44600 |
| Flash Point | 167.1ºC |
| Exact Mass | 296.21400 |
| PSA | 20.23000 |
| LogP | 5.57800 |
| Index of Refraction | 1.539 |
| InChIKey | ZAAQJFLUOUQAOG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(Cc2ccccc2)cc(C(C)(C)C)c1O |
|
~%
4-benzyl-2,6-di... CAS#:4973-27-7 |
| Literature: Coffield et al. Journal of the American Chemical Society, 1957 , vol. 79, p. 5019,5021 |
|
~%
4-benzyl-2,6-di... CAS#:4973-27-7 |
| Literature: Stillson; Sawyer; Hunt Journal of the American Chemical Society, 1945 , vol. 67, p. 303,305 |
|
~%
4-benzyl-2,6-di... CAS#:4973-27-7 |
| Literature: Nishinaga,A. et al. Tetrahedron, 1979 , vol. 35, p. 2493 - 2499 |
| 2.6-Di-tert.-butyl-4-benzyl-phenol |
| 2-Hydroxy-1.3-di-tert.-butyl-5-benzyl-benzol |
| 4-Hydroxy-3,5-di-tert.-butyl-diphenylmethan |
| 4-Benzyl-2,6-di-tert-butyl-phenol |