bis(4-nitrophenyl) nonanedioate structure
|
Common Name | bis(4-nitrophenyl) nonanedioate | ||
|---|---|---|---|---|
| CAS Number | 49759-34-4 | Molecular Weight | 430.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(4-nitrophenyl) nonanedioate |
|---|
| Molecular Formula | C21H22N2O8 |
|---|---|
| Molecular Weight | 430.40800 |
| Exact Mass | 430.13800 |
| PSA | 144.24000 |
| LogP | 5.79110 |
| InChIKey | WVRQLWQXFNTEJU-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCC(=O)Oc1ccc([N+](=O)[O-])cc1)Oc1ccc([N+](=O)[O-])cc1 |
|
~84%
bis(4-nitrophen... CAS#:49759-34-4 |
| Literature: Okuno, Yohmei; Horita, Kiyoshi; Yonemitsu, Osamu; Shibata, Kazue; Amemiya, Toshiyuki; Holm, Richard H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 5 p. 1115 - 1118 |
|
~%
bis(4-nitrophen... CAS#:49759-34-4 |
| Literature: Zahn,H.; Schade,F. Chemische Berichte, 1963 , vol. 96, p. 1747 - 1750 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |