4-(1-aminoethyl)benzenesulfonamide structure
|
Common Name | 4-(1-aminoethyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 49783-81-5 | Molecular Weight | 200.25800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12N2O2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | 4-(1-aminoethyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H12N2O2S |
|---|---|
| Molecular Weight | 200.25800 |
| Exact Mass | 200.06200 |
| PSA | 94.56000 |
| LogP | 2.83510 |
| InChIKey | YIGSCEUQIQKFPL-UHFFFAOYSA-N |
| SMILES | CC(N)c1ccc(S(N)(=O)=O)cc1 |
|
~%
4-(1-aminoethyl... CAS#:49783-81-5 |
| Literature: Jensen; Schmith Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1944 , vol. 280, p. 35,38 |
|
~%
4-(1-aminoethyl... CAS#:49783-81-5 |
| Literature: Burton; Hu Journal of the Chemical Society, 1949 , p. 178,179 |
|
~%
4-(1-aminoethyl... CAS#:49783-81-5 |
| Literature: Jensen; Schmith Hoppe-Seyler's Zeitschrift fuer Physiologische Chemie, 1944 , vol. 280, p. 35,38 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD06357420 |