1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione
![1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione Structure](https://image.chemsrc.com/caspic/480/49786-32-5.png)
1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione structure
|
Common Name | 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 49786-32-5 | Molecular Weight | 180.20400 | |
| Density | 1.28g/cm3 | Boiling Point | 288.8ºC at 760 mmHg | |
| Molecular Formula | C9H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 288.8ºC at 760 mmHg |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.20400 |
| Flash Point | 126.1ºC |
| Exact Mass | 180.09000 |
| PSA | 44.00000 |
| Index of Refraction | 1.584 |
| InChIKey | BDLFOWSQKJPVEK-UHFFFAOYSA-N |
| SMILES | Cn1c2c(c(=O)n(C)c1=O)CCC2 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,3-dimethyl-6,... CAS#:49786-32-5 |
| Literature: deStevens et al. Archives of Biochemistry, 1959 , vol. 83, p. 141,148 |
|
~%
1,3-dimethyl-6,... CAS#:49786-32-5 |
| Literature: deStevens et al. Archives of Biochemistry, 1959 , vol. 83, p. 141,148 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3-dimethyl-5,6-trimethyleneuracil |
| 1,3-Dimethyl-1,5,6,7-tetrahydro-cyclopentapyrimidin-2,4-dion |
| 1,3-dimethyl-1,5,6,7-tetrahydro-cyclopentapyrimidine-2,4-dione |
| 5,6-trimethylene-1,3-dimethyluracil |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione? |
| A: Molecular formula of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione is C9H12N2O2. |
| Q: What English synonyms does 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione have? |
| A: English synonyms of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione: 1,3-dimethyl-5,6-trimethyleneuracil, 1,3-Dimethyl-1,5,6,7-tetrahydro-cyclopentapyrimidin-2,4-dion, 1,3-dimethyl-1,5,6,7-tetrahydro-cyclopentapyrimidine-2,4-dione, 5,6-trimethylene-1,3-dimethyluracil. |
| Q: What is the English name of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione? |
| A: The English name of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione is 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione. |
| Q: What is the Chinese name of 49786-32-5? |
| A: Chinese name of 49786-32-5 is 49786-32-5. |
| Q: What are the upstream materials of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione? |
| A: Related upstream materials(CAS) of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione: 611-10-9;5466-00-2;77-78-1. |
| Q: What is the polar surface area (PSA) of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione? |
| A: Polar surface area (PSA) of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione is 44.00000. |
| Q: What is the InChIKey of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione? |
| A: InChIKey of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione is BDLFOWSQKJPVEK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione? |
| A: SMILES notation of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione is Cn1c2c(c(=O)n(C)c1=O)CCC2. |
| Q: What is the CAS number of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione? |
| A: CAS number of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione is 49786-32-5. |
| Q: What is the boiling point of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione? |
| A: Boiling point of 1,3-dimethyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-2,4-dione is 288.8ºC at 760 mmHg. |