ethyl 2-(4-cyanophenoxy)propanoate
ethyl 2-(4-cyanophenoxy)propanoate structure
|
Common Name | ethyl 2-(4-cyanophenoxy)propanoate | ||
|---|---|---|---|---|
| CAS Number | 49786-89-2 | Molecular Weight | 219.23700 | |
| Density | 1.14g/cm3 | Boiling Point | 343.4ºC at 760 mmHg | |
| Molecular Formula | C12H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 2-(4-cyanophenoxy)propanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 343.4ºC at 760 mmHg |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.23700 |
| Flash Point | 149.9ºC |
| Exact Mass | 219.09000 |
| PSA | 59.32000 |
| LogP | 1.88868 |
| Index of Refraction | 1.515 |
| InChIKey | RWXRNKHVAIGPSA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)Oc1ccc(C#N)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~81%
ethyl 2-(4-cyan... CAS#:49786-89-2 |
| Literature: Andreini; Biagi; Giorgi; Livi; Scartoni Farmaco, 1989 , vol. 44, # 9 p. 831 - 841 |
|
~%
ethyl 2-(4-cyan... CAS#:49786-89-2 |
| Literature: Biagi; Dell'Omodarme; Ferretti; Giorgi; Livi; Scartoni Farmaco, 1992 , vol. 47, # 3 p. 335 - 344 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of ethyl 2-(4-cyanophenoxy)propanoate? |
| A: Polar surface area (PSA) of ethyl 2-(4-cyanophenoxy)propanoate is 59.32000. |
| Q: What is the boiling point of ethyl 2-(4-cyanophenoxy)propanoate? |
| A: Boiling point of ethyl 2-(4-cyanophenoxy)propanoate is 343.4ºC at 760 mmHg. |
| Q: What is the SMILES notation of ethyl 2-(4-cyanophenoxy)propanoate? |
| A: SMILES notation of ethyl 2-(4-cyanophenoxy)propanoate is CCOC(=O)C(C)Oc1ccc(C#N)cc1. |
| Q: What is the LogP of ethyl 2-(4-cyanophenoxy)propanoate? |
| A: LogP of ethyl 2-(4-cyanophenoxy)propanoate is 1.88868. |
| Q: What is the InChIKey of ethyl 2-(4-cyanophenoxy)propanoate? |
| A: InChIKey of ethyl 2-(4-cyanophenoxy)propanoate is RWXRNKHVAIGPSA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of ethyl 2-(4-cyanophenoxy)propanoate? |
| A: Molecular formula of ethyl 2-(4-cyanophenoxy)propanoate is C12H13NO3. |
| Q: What is the CAS number of ethyl 2-(4-cyanophenoxy)propanoate? |
| A: CAS number of ethyl 2-(4-cyanophenoxy)propanoate is 49786-89-2. |
| Q: What is the Chinese name of 49786-89-2? |
| A: Chinese name of 49786-89-2 is 49786-89-2. |
| Q: What are the upstream materials of ethyl 2-(4-cyanophenoxy)propanoate? |
| A: Related upstream materials(CAS) of ethyl 2-(4-cyanophenoxy)propanoate: 767-00-0;535-11-5;28059-75-8;151-50-8. |
| Q: What is the molecular weight of ethyl 2-(4-cyanophenoxy)propanoate? |
| A: Molecular weight of ethyl 2-(4-cyanophenoxy)propanoate is 219.23700. |