4-methyl-2-(2,4,4-trimethylpentan-2-yl)phenol structure
|
Common Name | 4-methyl-2-(2,4,4-trimethylpentan-2-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 4979-46-8 | Molecular Weight | 220.35000 | |
| Density | 0.93g/cm3 | Boiling Point | 293.9ºC at 760 mmHg | |
| Molecular Formula | C15H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.1ºC | |
| Name | 4-methyl-2-(2,4,4-trimethylpentan-2-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.93g/cm3 |
|---|---|
| Boiling Point | 293.9ºC at 760 mmHg |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35000 |
| Flash Point | 136.1ºC |
| Exact Mass | 220.18300 |
| PSA | 20.23000 |
| LogP | 4.41440 |
| Index of Refraction | 1.501 |
| InChIKey | MWJFTXUNWYQEIU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(O)c(C(C)(C)CC(C)(C)C)c1 |
|
~%
4-methyl-2-(2,4... CAS#:4979-46-8 |
| Literature: Kitchen Journal of the American Chemical Society, 1948 , vol. 70, p. 1290 |
|
~%
4-methyl-2-(2,4... CAS#:4979-46-8 |
| Literature: Kahovec,J.; Pospisil,J. Collection of Czechoslovak Chemical Communications, 1968 , vol. 33, p. 1709 - 1729 |
|
~%
Detail
|
| Literature: SCHENECTADY INTERNATIONAL, INC. Patent: WO2006/74401 A1, 2006 ; Location in patent: Page/Page column 25 ; |
| 4-Methyl-2-tert-octylphenol |
| 4-Methyl-2-t-octylphenol |
| 2-t-octyl-p-cresol |
| 4-Methyl-2-<1,1,3,3-tetramethyl-butyl>-phenol |
| 2-t-octyl-4-methylphenol |