3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate
Modify Date: 2026-07-30 16:25:23
3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate structure
|
Common Name | 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate | ||
|---|---|---|---|---|
| CAS Number | 497931-77-8 | Molecular Weight | 290.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11ClOS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11ClOS3 |
|---|---|
| Molecular Weight | 290.9 |
| InChIKey | NWTXFQVYTZESOP-UHFFFAOYSA-N |
| SMILES | O=C(Cl)CCSC(=S)SCc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 497931-77-8? |
| A: Chinese name of 497931-77-8 is 497931-77-8. |
| Q: What is the InChIKey of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate? |
| A: InChIKey of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate is NWTXFQVYTZESOP-UHFFFAOYSA-N. |
| Q: What is the English name of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate? |
| A: The English name of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate is 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate. |
| Q: What is the SMILES notation of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate? |
| A: SMILES notation of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate is O=C(Cl)CCSC(=S)SCc1ccccc1. |
| Q: What is the molecular weight of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate? |
| A: Molecular weight of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate is 290.9. |
| Q: What is the CAS number of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate? |
| A: CAS number of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate is 497931-77-8. |
| Q: What is the molecular formula of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate? |
| A: Molecular formula of 3-Chloro-3-oxopropyl phenylmethyl carbonotrithioate is C11H11ClOS3. |