N-(4-Methyl-2,6-dinitrophenyl)acetamide structure
|
Common Name | N-(4-Methyl-2,6-dinitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 49804-47-9 | Molecular Weight | 239.18500 | |
| Density | 1.472g/cm3 | Boiling Point | 448.6ºC at 760 mmHg | |
| Molecular Formula | C9H9N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.1ºC | |
| Name | N-(4-Methyl-2,6-dinitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.472g/cm3 |
|---|---|
| Boiling Point | 448.6ºC at 760 mmHg |
| Molecular Formula | C9H9N3O5 |
| Molecular Weight | 239.18500 |
| Flash Point | 225.1ºC |
| Exact Mass | 239.05400 |
| PSA | 124.23000 |
| LogP | 3.46570 |
| Index of Refraction | 1.638 |
| InChIKey | OFIDOLGSIHMBKD-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c([N+](=O)[O-])cc(C)cc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-Methyl-2,6... CAS#:49804-47-9 |
| Literature: Niementowski Chemische Berichte, 1886 , vol. 19, p. 717 |
|
~%
N-(4-Methyl-2,6... CAS#:49804-47-9 |
| Literature: Kniphorst Recueil des Travaux Chimiques des Pays-Bas, 1925 , vol. 44, p. 704 |
|
~%
N-(4-Methyl-2,6... CAS#:49804-47-9 |
| Literature: Niementowski Chemische Berichte, 1886 , vol. 19, p. 717 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3,5-dinitro-4(N-acetyl)aminotoluene |
| 4,6-Dimethyl-2-nitro-acetanilid |
| N-(4-Methyl-2,6-Dinitrophenyl)-Acetamide |
| 2,6-Dinitro-4-methylacetanilide |
| acetic acid-(4-methyl-2,6-dinitro-anilide) |
| 4'-Methyl-2',6'-dinitroacetanilid |
| 3.5-Dinitro-4-acetamino-toluol |
| Essigsaeure-(4-methyl-2,6-dinitro-anilid) |