3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one
Modify Date: 2026-06-26 13:26:49
![3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one Structure](https://www.chemsrc.com/extcaspic/388/49835-63-4.png)
3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one structure
|
Common Name | 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 49835-63-4 | Molecular Weight | 316.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16O6 |
|---|---|
| Molecular Weight | 316.3 |
| InChIKey | GDVXNIUZGNCPOX-GQCTYLIASA-N |
| SMILES | CC1=CC(=C(C(=O)O1)C(=O)/C=C/C2=CC(=C(C=C2)OC)OC)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Induction of adiponectin biosynthesis in human BMMSC cells assessed as adiponectin le...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5386740
|
|
Name: Induction of leptin biosynthesis in human BMMSC cells assessed as leptin level at 10 ...
Source: ChEMBL
Target: N/A
External Id: CHEMBL5386741
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one? |
| A: Molecular weight of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one is 316.3. |
| Q: What is the English name of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one? |
| A: The English name of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one is 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one. |
| Q: What is the SMILES notation of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one? |
| A: SMILES notation of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one is CC1=CC(=C(C(=O)O1)C(=O)/C=C/C2=CC(=C(C=C2)OC)OC)O. |
| Q: What is the molecular formula of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one? |
| A: Molecular formula of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one is C17H16O6. |
| Q: What is the Chinese name of 49835-63-4? |
| A: Chinese name of 49835-63-4 is 49835-63-4. |
| Q: What is the InChIKey of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one? |
| A: InChIKey of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one is GDVXNIUZGNCPOX-GQCTYLIASA-N. |
| Q: What is the CAS number of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one? |
| A: CAS number of 3-[(2E)-3-(3,4-Dimethoxyphenyl)prop-2-enoyl]-4-hydroxy-6-methyl-2H-pyran-2-one is 49835-63-4. |