5-[(4-nitrobenzoyl)amino]pentanoic acid
![5-[(4-nitrobenzoyl)amino]pentanoic acid Structure](https://image.chemsrc.com/caspic/002/4986-87-2.png)
5-[(4-nitrobenzoyl)amino]pentanoic acid structure
|
Common Name | 5-[(4-nitrobenzoyl)amino]pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 4986-87-2 | Molecular Weight | 266.25000 | |
| Density | 1.316g/cm3 | Boiling Point | 543.7ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(4-nitrobenzoyl)amino]pentanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.316g/cm3 |
|---|---|
| Boiling Point | 543.7ºC at 760 mmHg |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25000 |
| Flash Point | 282.6ºC |
| Exact Mass | 266.09000 |
| PSA | 112.22000 |
| LogP | 2.49360 |
| Index of Refraction | 1.571 |
| InChIKey | JYXHOGZHGJXNRA-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCNC(=O)c1ccc([N+](=O)[O-])cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-[(4-nitrobenz... CAS#:4986-87-2 |
| Literature: Archer et al. Journal of the American Pharmaceutical Association (1912-1977), 1951 , vol. 40, p. 143,144, 149 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-[(4-nitrobenzoyl)amino]pentanoic acid? |
| A: The English name of 5-[(4-nitrobenzoyl)amino]pentanoic acid is 5-[(4-nitrobenzoyl)amino]pentanoic acid. |
| Q: What is the Chinese name of 4986-87-2? |
| A: Chinese name of 4986-87-2 is 4986-87-2. |
| Q: What is the molecular formula of 5-[(4-nitrobenzoyl)amino]pentanoic acid? |
| A: Molecular formula of 5-[(4-nitrobenzoyl)amino]pentanoic acid is C12H14N2O5. |
| Q: What is the SMILES notation of 5-[(4-nitrobenzoyl)amino]pentanoic acid? |
| A: SMILES notation of 5-[(4-nitrobenzoyl)amino]pentanoic acid is O=C(O)CCCCNC(=O)c1ccc([N+](=O)[O-])cc1. |
| Q: What is the molecular weight of 5-[(4-nitrobenzoyl)amino]pentanoic acid? |
| A: Molecular weight of 5-[(4-nitrobenzoyl)amino]pentanoic acid is 266.25000. |
| Q: What are the upstream materials of 5-[(4-nitrobenzoyl)amino]pentanoic acid? |
| A: Related upstream materials(CAS) of 5-[(4-nitrobenzoyl)amino]pentanoic acid: 20857-92-5. |
| Q: What is the CAS number of 5-[(4-nitrobenzoyl)amino]pentanoic acid? |
| A: CAS number of 5-[(4-nitrobenzoyl)amino]pentanoic acid is 4986-87-2. |
| Q: What is the LogP of 5-[(4-nitrobenzoyl)amino]pentanoic acid? |
| A: LogP of 5-[(4-nitrobenzoyl)amino]pentanoic acid is 2.49360. |
| Q: What is the polar surface area (PSA) of 5-[(4-nitrobenzoyl)amino]pentanoic acid? |
| A: Polar surface area (PSA) of 5-[(4-nitrobenzoyl)amino]pentanoic acid is 112.22000. |
| Q: What is the boiling point of 5-[(4-nitrobenzoyl)amino]pentanoic acid? |
| A: Boiling point of 5-[(4-nitrobenzoyl)amino]pentanoic acid is 543.7ºC at 760 mmHg. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |