Boc-3-Methyl-D-beta-phenylalanine structure
|
Common Name | Boc-3-Methyl-D-beta-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 499995-75-4 | Molecular Weight | 279.332 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 436.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO4 | Melting Point | 116 - 119 °C | |
| MSDS | USA | Flash Point | 217.7±27.3 °C | |
| Name | (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.3±40.0 °C at 760 mmHg |
| Melting Point | 116 - 119 °C |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.332 |
| Flash Point | 217.7±27.3 °C |
| Exact Mass | 279.147064 |
| PSA | 75.63000 |
| LogP | 3.18 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | XICHKLMIOJEDAM-LBPRGKRZSA-N |
| SMILES | Cc1cccc(C(CC(=O)O)NC(=O)OC(C)(C)C)c1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-[(tert-Butoxycarbonyl)amino]-3-(3-methylphenyl)propanoic acid |
| MFCD03427896 |
| (3S)-3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 3-tert-Butoxycarbonylamino-3-m-tolyl-propionic acid |