Boc-3-Methyl-D-beta-phenylalanine
Boc-3-Methyl-D-beta-phenylalanine structure
|
Common Name | Boc-3-Methyl-D-beta-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 499995-75-4 | Molecular Weight | 279.332 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 436.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO4 | Melting Point | 116 - 119 °C | |
| MSDS | USA | Flash Point | 217.7±27.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 436.3±40.0 °C at 760 mmHg |
| Melting Point | 116 - 119 °C |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.332 |
| Flash Point | 217.7±27.3 °C |
| Exact Mass | 279.147064 |
| PSA | 75.63000 |
| LogP | 3.18 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | XICHKLMIOJEDAM-LBPRGKRZSA-N |
| SMILES | Cc1cccc(C(CC(=O)O)NC(=O)OC(C)(C)C)c1 |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-[(tert-Butoxycarbonyl)amino]-3-(3-methylphenyl)propanoic acid |
| MFCD03427896 |
| (3S)-3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 3-(3-Methylphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| 3-tert-Butoxycarbonylamino-3-m-tolyl-propionic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: Melting point of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is 116 - 119 °C. |
| Q: What is the molecular formula of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: Molecular formula of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is C15H21NO4. |
| Q: What is the polar surface area (PSA) of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: Polar surface area (PSA) of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is 75.63000. |
| Q: What is the InChIKey of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: InChIKey of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is XICHKLMIOJEDAM-LBPRGKRZSA-N. |
| Q: What is the CAS number of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: CAS number of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is 499995-75-4. |
| Q: What is the SMILES notation of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: SMILES notation of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is Cc1cccc(C(CC(=O)O)NC(=O)OC(C)(C)C)c1. |
| Q: What is the LogP of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: LogP of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is 3.18. |
| Q: What is the boiling point of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: Boiling point of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is 436.3±40.0 °C at 760 mmHg. |
| Q: What is the molecular weight of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: Molecular weight of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is 279.332. |
| Q: What is the English name of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid? |
| A: The English name of (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid is (3S)-3-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |