boc-(s)-3-amino-3-(2-methoxy-phenyl)-propionic acid structure
|
Common Name | boc-(s)-3-amino-3-(2-methoxy-phenyl)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 499995-76-5 | Molecular Weight | 295.331 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 466.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8±28.7 °C | |
| Name | (S)-3-((tert-Butoxycarbonyl)amino)-3-(2-methoxyphenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 466.3±45.0 °C at 760 mmHg |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.331 |
| Flash Point | 235.8±28.7 °C |
| Exact Mass | 295.141968 |
| PSA | 84.86000 |
| LogP | 2.63 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | HTVHHPNRENCUJY-NSHDSACASA-N |
| SMILES | COc1ccccc1C(CC(=O)O)NC(=O)OC(C)(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (3S)-3-(2-Methoxyphenyl)-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)propanoic acid |
| Benzenepropanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]-2-methoxy-, (βS)- |
| (3S)-3-(2-methoxyphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |