Boc-(S)-3-Amino-3-(2,3-dichlorophenyl)-propionic acid structure
|
Common Name | Boc-(S)-3-Amino-3-(2,3-dichlorophenyl)-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 499995-82-3 | Molecular Weight | 334.19500 | |
| Density | 1.321g/cm3 | Boiling Point | 468.939°C at 760 mmHg | |
| Molecular Formula | C14H17Cl2NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.406°C | |
| Name | (3S)-3-(2,3-dichlorophenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 468.939°C at 760 mmHg |
| Molecular Formula | C14H17Cl2NO4 |
| Molecular Weight | 334.19500 |
| Flash Point | 237.406°C |
| Exact Mass | 333.05300 |
| PSA | 75.63000 |
| LogP | 4.42480 |
| Index of Refraction | 1.548 |
| InChIKey | KGXWCCCBQSYUKL-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)c1cccc(Cl)c1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Boc-(S)-3-Amino-3-(2,3-dichlorophenyl)-propionic acid |