trichlorobenzoic acid
trichlorobenzoic acid structure
|
Common Name | trichlorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 50-75-9 | Molecular Weight | 225.456 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 340.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C7H3Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.6±26.5 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,3,4-trichlorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.3±37.0 °C at 760 mmHg |
| Molecular Formula | C7H3Cl3O2 |
| Molecular Weight | 225.456 |
| Flash Point | 159.6±26.5 °C |
| Exact Mass | 223.919861 |
| PSA | 37.30000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | ALLSOOQIDPLIER-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cl)c(Cl)c1Cl |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2916399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| BENZOIC ACID,2,3,4-TRICHLORO |
| 2,3,4,5,6-PENTACHLOROPYRIDINE |
| 2,3,4-Trichlorobenzoic acid |
| 2,3,4-trichloro-benzoic acid |
| trichlorobenzoic acid |
| 2,3,4-Trichlor-benzoesaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,3,4-trichlorobenzoic acid? |
| A: Polar surface area (PSA) of 2,3,4-trichlorobenzoic acid is 37.30000. |
| Q: What English synonyms does 2,3,4-trichlorobenzoic acid have? |
| A: English synonyms of 2,3,4-trichlorobenzoic acid: BENZOIC ACID,2,3,4-TRICHLORO, 2,3,4,5,6-PENTACHLOROPYRIDINE, 2,3,4-Trichlorobenzoic acid, 2,3,4-trichloro-benzoic acid, trichlorobenzoic acid, 2,3,4-Trichlor-benzoesaeure. |
| Q: What is the molecular formula of 2,3,4-trichlorobenzoic acid? |
| A: Molecular formula of 2,3,4-trichlorobenzoic acid is C7H3Cl3O2. |
| Q: What is the InChIKey of 2,3,4-trichlorobenzoic acid? |
| A: InChIKey of 2,3,4-trichlorobenzoic acid is ALLSOOQIDPLIER-UHFFFAOYSA-N. |
| Q: What is the LogP of 2,3,4-trichlorobenzoic acid? |
| A: LogP of 2,3,4-trichlorobenzoic acid is 3.56. |
| Q: What is the SMILES notation of 2,3,4-trichlorobenzoic acid? |
| A: SMILES notation of 2,3,4-trichlorobenzoic acid is O=C(O)c1ccc(Cl)c(Cl)c1Cl. |
| Q: What is the molecular weight of 2,3,4-trichlorobenzoic acid? |
| A: Molecular weight of 2,3,4-trichlorobenzoic acid is 225.456. |
| Q: What is the boiling point of 2,3,4-trichlorobenzoic acid? |
| A: Boiling point of 2,3,4-trichlorobenzoic acid is 340.3±37.0 °C at 760 mmHg. |
| Q: What is the English name of 2,3,4-trichlorobenzoic acid? |
| A: The English name of 2,3,4-trichlorobenzoic acid is 2,3,4-trichlorobenzoic acid. |
| Q: What is the CAS number of 2,3,4-trichlorobenzoic acid? |
| A: CAS number of 2,3,4-trichlorobenzoic acid is 50-75-9. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |