1-(Cyclohexylcarbonyl)-2,6-dimethylpiperidine structure
|
Common Name | 1-(Cyclohexylcarbonyl)-2,6-dimethylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 5005-28-7 | Molecular Weight | 223.35400 | |
| Density | 0.965g/cm3 | Boiling Point | 346ºC at 760 mmHg | |
| Molecular Formula | C14H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.5ºC | |
| Name | cyclohexyl-(2,6-dimethylpiperidin-1-yl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 0.965g/cm3 |
|---|---|
| Boiling Point | 346ºC at 760 mmHg |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.35400 |
| Flash Point | 142.5ºC |
| Exact Mass | 223.19400 |
| PSA | 20.31000 |
| LogP | 3.29410 |
| Index of Refraction | 1.485 |
| InChIKey | CFSVDFDJZBYXIZ-UHFFFAOYSA-N |
| SMILES | CC1CCCC(C)N1C(=O)C1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AI3-3654Oa |
| HMS2563H17 |