1,3-Diazaspiro[4.4]nonane-2,4-dione,6-phenyl- structure
|
Common Name | 1,3-Diazaspiro[4.4]nonane-2,4-dione,6-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 5007-34-1 | Molecular Weight | 230.26200 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9-phenyl-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.26200 |
| Exact Mass | 230.10600 |
| PSA | 58.20000 |
| LogP | 2.18990 |
| Index of Refraction | 1.62 |
| InChIKey | DBNCOCOSCWVAGJ-UHFFFAOYSA-N |
| SMILES | O=C1NC(=O)C2(CCCC2c2ccccc2)N1 |
|
~21%
1,3-Diazaspiro[... CAS#:5007-34-1 |
| Literature: Sarges; Schnur; Belletire; Peterson Journal of Medicinal Chemistry, 1988 , vol. 31, # 1 p. 230 - 243 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 6-Phenyl-1.3-diazaspiro<4.4>nonan-2.4-dion |