5-Benzyloxy-2-methyl-benzofuran-carbonsaeure-(3)
Modify Date: 2025-08-27 20:41:47
5-Benzyloxy-2-methyl-benzofuran-carbonsaeure-(3) structure
|
Common Name | 5-Benzyloxy-2-methyl-benzofuran-carbonsaeure-(3) | ||
|---|---|---|---|---|
| CAS Number | 5010-53-7 | Molecular Weight | 282.29100 | |
| Density | 1.283g/cm3 | Boiling Point | 475.4ºC at 760 mmHg | |
| Molecular Formula | C17H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
| Name | 5-Benzyloxy-2-methyl-benzofuran-carbonsaeure-(3) |
|---|
| Density | 1.283g/cm3 |
|---|---|
| Boiling Point | 475.4ºC at 760 mmHg |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.29100 |
| Flash Point | 241.3ºC |
| Exact Mass | 282.08900 |
| PSA | 59.67000 |
| LogP | 4.01840 |
| Index of Refraction | 1.641 |
| InChIKey | YYQFBUCGMUABMK-UHFFFAOYSA-N |
| SMILES | Cc1oc2ccc(OCc3ccccc3)cc2c1C(=O)O |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |